THIS ARTICLE IS PURELY THEORETICAL.
Cinnamylidene-Lysergamide (CLSA) is an unlikely theoretical adduct of lysergamine (LSA) and cinnamaldehyde. It's composed of 1 molecule of lysergamine and 1 molecule of cinnamaldehyde. This adduct's theoretical formation is based on the adduct LSH, which is 1 molecule of LSA and 1 molecule of acetaldehyde. However, this kind of formation is not common for cinnamaldehyde based amide adducts, where adducts are often 2 molecules of the amide and 1 molecule of the aldehdye.
Cinnamylidene-Bislysergamide (CDLSA) is the more likely theoretical adduct of lysergamine (LSA) and cinnamaldehyde. It's composed of 2 molecules of lysergamine and 1 molecule of cinnamaldehyde.
It's theorized that this adduct forms a 2:1 ratio based on similar cinnamaldehyde adducts such as cinnamylidene-bisacetamide and cinnamylidene-bisphenylacetamide, which are proven to form without the need for a catalyst.
| Adduct Reactants | End Product | |
|---|---|---|
| LSA | Cinnamaldehyde | Cinnamylidene-Lysergamide |
 |
 |
|
Chemical Properties
Synonyms: Cinnamylidene-ergine; CLSA
Canonical SMILES: CN1C[C@@H](C=C2[C@H]1CC3=C[N](C4=CC=CC2=C34)[H])C(=O)N(C(/C(=C(/C5=CC=CC=C5)[H])[H])O)[H]