
3'-(Glutathion-S-yl)-1'-Oxomethyleugenol is the glutathione adduct of 1'-oxomethyleugenol. It's not know to what extent the enzyme glutathione S-transferase (GST) is involved in its creation. It's possible that this adduct can form spontaneously without an enzyme catalyst, as this is proven to be the case for the very closely related compounds 1'-oxosafrole and 1'-oxoestragole.
The formation of 3'-(Glutathion-S-yl)-1'-Oxomethyleugenol from 1'-oxomethyleugenol prevents 1'-oxomethyleugenol from forming psychoactive alkaloids from endogenous amines.
Substrate | GST | End Product |
---|---|---|
1'-Oxomethyleugenol | 3'-(Glutathion-S-yl)-1'-Oxomethyleugenol | |
![]() |
![]() |
Chemical Properties
Molecular Weight: 499.60[g/mol]
Formula: C21H29N3O9S
XLogP3: -2.88[1]
Canonical SMILES: S(CC(C(=O)N(CC(=O)O[H])[H])N(C(=O)CCC(C(=O)O[H])N([H])[H])[H])CCC(C1=CC(=C(C=C1)OC)OC)=O